Tenofovir D6 structure
|
Common Name | Tenofovir D6 | ||
|---|---|---|---|---|
| CAS Number | 1020719-94-1 | Molecular Weight | 287.21200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14N5O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tenofovir D6(Rac)-Tenofovir-d6 ((Rac)-GS 1278-d6) is a labelled racemic Tenofovir. Tenofovir (GS 1278) is a nucleotide reverse transcriptase inhibitor to treat HIV and chronic Hepatitis B (HBV)[1]. |
| Name | rac Tenofovir-d6 |
|---|---|
| Synonym | More Synonyms |
| Description | (Rac)-Tenofovir-d6 ((Rac)-GS 1278-d6) is a labelled racemic Tenofovir. Tenofovir (GS 1278) is a nucleotide reverse transcriptase inhibitor to treat HIV and chronic Hepatitis B (HBV)[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C9H14N5O4P |
|---|---|
| Molecular Weight | 287.21200 |
| Exact Mass | 287.07800 |
| PSA | 146.19000 |
| LogP | 0.53000 |
| InChIKey | SGOIRFVFHAKUTI-CUYPRXAISA-N |
| SMILES | CC(Cn1cnc2c(N)ncnc21)OCP(=O)(O)O |
| [1-(6-aminopurin-9-yl)-1,1,2,3,3,3-hexadeuteriopropan-2-yl]oxymethylphosphonic acid |
| Tenofovir D6 |