6-chloro-5-hydroxyisoquinoline-7,8-dione structure
|
Common Name | 6-chloro-5-hydroxyisoquinoline-7,8-dione | ||
|---|---|---|---|---|
| CAS Number | 102072-79-7 | Molecular Weight | 209.58600 | |
| Density | 1.66g/cm3 | Boiling Point | 385.2ºC at 760 mmHg | |
| Molecular Formula | C9H4ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.7ºC | |
| Name | 6-chloro-5-hydroxyisoquinoline-7,8-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.66g/cm3 |
|---|---|
| Boiling Point | 385.2ºC at 760 mmHg |
| Molecular Formula | C9H4ClNO3 |
| Molecular Weight | 209.58600 |
| Flash Point | 186.7ºC |
| Exact Mass | 208.98800 |
| PSA | 67.26000 |
| LogP | 1.31240 |
| Vapour Pressure | 1.27E-06mmHg at 25°C |
| Index of Refraction | 1.67 |
| InChIKey | SERGBLQEPAHAPR-UHFFFAOYSA-N |
| SMILES | O=C1C(=O)c2cnccc2C(O)=C1Cl |
|
~87%
6-chloro-5-hydr... CAS#:102072-79-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 29, # 8 p. 1329 - 1340 |
|
~%
6-chloro-5-hydr... CAS#:102072-79-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 29, # 8 p. 1329 - 1340 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5,8-Isoquinolinedione,6-chloro-7-hydroxy |
| 6-Chloro-7-hydroxy-5,8-isoquinolinedione |