5-hydroxy-7,8-dioxoisoquinoline-6-carbonitrile structure
|
Common Name | 5-hydroxy-7,8-dioxoisoquinoline-6-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 102072-81-1 | Molecular Weight | 200.15000 | |
| Density | 1.6g/cm3 | Boiling Point | 403.5ºC at 760 mmHg | |
| Molecular Formula | C10H4N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.8ºC | |
| Name | 5-hydroxy-7,8-dioxoisoquinoline-6-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6g/cm3 |
|---|---|
| Boiling Point | 403.5ºC at 760 mmHg |
| Molecular Formula | C10H4N2O3 |
| Molecular Weight | 200.15000 |
| Flash Point | 197.8ºC |
| Exact Mass | 200.02200 |
| PSA | 91.05000 |
| LogP | 0.63968 |
| Vapour Pressure | 3.1E-07mmHg at 25°C |
| Index of Refraction | 1.675 |
| InChIKey | ZPHJVKARMANJIT-UHFFFAOYSA-N |
| SMILES | N#CC1=C(O)c2ccncc2C(=O)C1=O |
| HS Code | 2933499090 |
|---|
|
~36%
5-hydroxy-7,8-d... CAS#:102072-81-1 |
| Literature: Shaikh; Johnson; Grollman Journal of Medicinal Chemistry, 1986 , vol. 29, # 8 p. 1329 - 1340 |
|
~%
5-hydroxy-7,8-d... CAS#:102072-81-1 |
| Literature: Shaikh; Johnson; Grollman Journal of Medicinal Chemistry, 1986 , vol. 29, # 8 p. 1329 - 1340 |
|
~%
5-hydroxy-7,8-d... CAS#:102072-81-1 |
| Literature: Shaikh; Johnson; Grollman Journal of Medicinal Chemistry, 1986 , vol. 29, # 8 p. 1329 - 1340 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-hydroxy-7,8-dioxo-7,8-dihydroisoquinoline-6-carbonitrile |
| 6-cyano-7-hydroxy-5,8-isoquinolinedione |
| 6-Isoquinolinecarbonitrile,5,8-dihydro-7-hydroxy-5,8-dioxo |
| 5,8-Dihydro-7-hydroxy-5,8-dioxo-6-isoquinolinecarbonitrile |