trimethyl-(4-trimethylsilyl-1,2,4,5-tetrazin-1-yl)silane structure
|
Common Name | trimethyl-(4-trimethylsilyl-1,2,4,5-tetrazin-1-yl)silane | ||
|---|---|---|---|---|
| CAS Number | 102101-03-1 | Molecular Weight | 228.44200 | |
| Density | 0.96g/cm3 | Boiling Point | 219ºC at 760 mmHg | |
| Molecular Formula | C8H20N4Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 86.3ºC | |
| Name | trimethyl-(4-trimethylsilyl-1,2,4,5-tetrazin-1-yl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.96g/cm3 |
|---|---|
| Boiling Point | 219ºC at 760 mmHg |
| Molecular Formula | C8H20N4Si2 |
| Molecular Weight | 228.44200 |
| Flash Point | 86.3ºC |
| Exact Mass | 228.12300 |
| PSA | 35.64000 |
| LogP | 2.00780 |
| Vapour Pressure | 0.122mmHg at 25°C |
| Index of Refraction | 1.485 |
| InChIKey | KAZZZEWCXJZBNC-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N1C=NN([Si](C)(C)C)C=N1 |
|
~20%
trimethyl-(4-tr... CAS#:102101-03-1 |
| Literature: Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), , p. 1633 - 1638 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,4-bis(trimethylsilyl)-1,4-dihydro-1,2,4,5-tetrazine |
| 1,2,4,5-Tetrazine,3,6-dihydro-3,6-bis(trimethylsilyl) |