APD916 structure
|
Common Name | APD916 | ||
|---|---|---|---|---|
| CAS Number | 1021169-11-8 | Molecular Weight | 401.56200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H31NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of APD916APD916 is a potent and selective antagonist of the H3 receptor with Ki of 0.7 nM for rH3R. |
| Name | (2R)-1-[2-[4-[4-(3-methoxypropylsulfonyl)phenyl]phenyl]ethyl]-2-methylpyrrolidine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H31NO3S |
|---|---|
| Molecular Weight | 401.56200 |
| Exact Mass | 401.20200 |
| PSA | 54.99000 |
| LogP | 5.20930 |
| InChIKey | ADRZQEOBUFIYAZ-LJQANCHMSA-N |
| SMILES | COCCCS(=O)(=O)c1ccc(-c2ccc(CCN3CCCC3C)cc2)cc1 |
| adp-916 |