Nemadectin structure
|
Common Name | Nemadectin | ||
|---|---|---|---|---|
| CAS Number | 102130-84-7 | Molecular Weight | 612.793 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 789.4±60.0 °C at 760 mmHg | |
| Molecular Formula | C36H52O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.8±26.4 °C | |
Use of NemadectinNemadectin (CL-287088), an orally active broad-spectrum endectocide, is highly efficacious against natural infections of all the major canine gastrointestinal helminthes. Anthelmintic activity[1]. |
| Name | Nemadectin |
|---|---|
| Synonym | More Synonyms |
| Description | Nemadectin (CL-287088), an orally active broad-spectrum endectocide, is highly efficacious against natural infections of all the major canine gastrointestinal helminthes. Anthelmintic activity[1]. |
|---|---|
| Related Catalog | |
| In Vivo | Nemadectin is highly effective at 0.6 mg/kg BW against natural infections of all major species of canine intestinal helminths, when administered as a single oral dose, either as a liquid or a tablet[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 789.4±60.0 °C at 760 mmHg |
| Molecular Formula | C36H52O8 |
| Molecular Weight | 612.793 |
| Flash Point | 243.8±26.4 °C |
| Exact Mass | 612.366211 |
| PSA | 114.68000 |
| LogP | 7.09 |
| Vapour Pressure | 0.0±6.2 mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | YNFMRVVYUVPIAN-MLTPGZJBSA-N |
| SMILES | CC1=CCC2CC(CC3(CC(O)C(C)C(C(C)=CC(C)C)O3)O2)OC(=O)C2C=C(C)C(O)C3OCC(=CC=CC(C)C1)C23O |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| F 28249a |
| AC-088 |
| (1'R,2R,4S,4'S,5S,6S,8'R,10'E,13'R,14'E,16'E,20'R,21'R,24'S)-4,21',24'-Trihydroxy-5,11',13',22'-tetramethyl-6-[(2E)-4-methyl-2-penten-2-yl]-3,4,5,6-tetrahydro-2'H-spiro[pyran-2,6'-[3,7,19]trioxatetrac ;yclo[15.6.1.1.0]pentacosa[10,14,16,22]tetraen]-2'-one |
| Antibiotic S-541A |
| S541 Factor D |
| LL F-28249a |
| (6R,23S,25S)-5-O-Demethyl-28-deoxy-25-[(E)-1,3-dimethyl-1-butenyl]-6,28-epoxy-23-hydroxymilbemycin B |