2-Chloro-4-pivalamidonicotinic acid structure
|
Common Name | 2-Chloro-4-pivalamidonicotinic acid | ||
|---|---|---|---|---|
| CAS Number | 1021339-24-1 | Molecular Weight | 256.68600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13ClN2O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | 2-chloro-4-(2,2-dimethylpropanoylamino)pyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13ClN2O3 |
|---|---|
| Molecular Weight | 256.68600 |
| Exact Mass | 256.06100 |
| PSA | 79.29000 |
| LogP | 2.49080 |
| InChIKey | FOGOGWIZSINXEC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)Nc1ccnc(Cl)c1C(=O)O |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-chloro-4-(2,2-dimethylpropanamido)pyridine-3-carboxylic acid |
| A-5861 |
| 2-Chloro-4-pivalamidonicotinic acid |