1-chloro-7-nitronaphthalene structure
|
Common Name | 1-chloro-7-nitronaphthalene | ||
|---|---|---|---|---|
| CAS Number | 102153-58-2 | Molecular Weight | 207.61300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H6ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-7-nitronaphthalene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H6ClNO2 |
|---|---|
| Molecular Weight | 207.61300 |
| Exact Mass | 207.00900 |
| PSA | 45.82000 |
| LogP | 3.92460 |
| InChIKey | GGHRRMKLOHCQEP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2cccc(Cl)c2c1 |
|
~%
1-chloro-7-nitr... CAS#:102153-58-2 |
| Literature: Eaborn,C. et al. Journal of the Chemical Society [Section] B: Physical Organic, 1968 , p. 1112 - 1123 |
|
~%
1-chloro-7-nitr... CAS#:102153-58-2 |
| Literature: Eaborn,C. et al. Journal of the Chemical Society [Section] B: Physical Organic, 1968 , p. 1112 - 1123 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| CL 2677 |
| 1-Chlor-7-nitro-naphthalin |
| 1-chloro-7-nitro-naphthalene |