5,12-dihydro-2-methylquino[2,3-b]acridine-7,14-dione structure
|
Common Name | 5,12-dihydro-2-methylquino[2,3-b]acridine-7,14-dione | ||
|---|---|---|---|---|
| CAS Number | 10228-01-0 | Molecular Weight | 326.34800 | |
| Density | 1.337g/cm3 | Boiling Point | 585.1ºC at 760mmHg | |
| Molecular Formula | C21H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.5ºC | |
| Name | 2-Methyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.337g/cm3 |
|---|---|
| Boiling Point | 585.1ºC at 760mmHg |
| Molecular Formula | C21H14N2O2 |
| Molecular Weight | 326.34800 |
| Flash Point | 221.5ºC |
| Exact Mass | 326.10600 |
| PSA | 65.72000 |
| LogP | 3.98440 |
| Vapour Pressure | 1.12E-13mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | MHNYFZUKHPYYCS-UHFFFAOYSA-N |
| SMILES | Cc1ccc2[nH]c3cc4c(=O)c5ccccc5[nH]c4cc3c(=O)c2c1 |
| HS Code | 2933990090 |
|---|
|
~%
Detail
|
| Literature: Mitina, Valentina K.; Gerzevske, Kevin Rodney; Biry, Stephane; Halik, Christine Patent: US2005/11403 A1, 2005 ; Location in patent: Page 14 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Quino(2,3-b)acridine-7,14-dione,5,12-dihydro-2-methyl |
| 5,12-Dihydro-2-methylquino(2,3-b)acridine-7,14-dione |
| 2-Methyl-chinacridon |
| EINECS 233-548-6 |