7-HYDROXYEMODIN structure
|
Common Name | 7-HYDROXYEMODIN | ||
|---|---|---|---|---|
| CAS Number | 10228-40-7 | Molecular Weight | 286.23600 | |
| Density | 1.693g/cm3 | Boiling Point | 524.7ºC at 760mmHg | |
| Molecular Formula | C15H10O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.2ºC | |
| Name | 1,2,3,8-tetrahydroxy-6-methylanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.693g/cm3 |
|---|---|
| Boiling Point | 524.7ºC at 760mmHg |
| Molecular Formula | C15H10O6 |
| Molecular Weight | 286.23600 |
| Flash Point | 285.2ºC |
| Exact Mass | 286.04800 |
| PSA | 115.06000 |
| LogP | 1.59280 |
| Vapour Pressure | 1.25E-11mmHg at 25°C |
| Index of Refraction | 1.781 |
| InChIKey | OWKHJRBCPBBUGG-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c2c(c1)C(=O)c1cc(O)c(O)c(O)c1C2=O |
| HS Code | 2914690090 |
|---|
|
~55%
7-HYDROXYEMODIN CAS#:10228-40-7 |
| Literature: Roberge, Guy; Brassard, Paul Journal of Organic Chemistry, 1981 , vol. 46, # 21 p. 4161 - 4166 |
|
~18%
7-HYDROXYEMODIN CAS#:10228-40-7 |
| Literature: Roberge, Guy; Brassard, Paul Journal of Organic Chemistry, 1981 , vol. 46, # 21 p. 4161 - 4166 |
|
~%
7-HYDROXYEMODIN CAS#:10228-40-7 |
| Literature: Roberge, Guy; Brassard, Paul Synthesis, 1981 , # 5 p. 381 - 383 |
| HS Code | 2914690090 |
|---|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 7-Hydroxyemodin |
| 1,2,3,8-Tetrahydroxy-6-methyl-anthrachinon |
| 1,2,3,8-tetrahydroxy-6-methylanthraquinone |
| 7-hydroxyemodine |
| Alaternin |
| 2-Hydroxyemodin |