2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane
2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane structure
|
Common Name | 2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane | ||
|---|---|---|---|---|
| CAS Number | 1024-07-3 | Molecular Weight | 344.41500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10P2S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H10P2S4 |
|---|---|
| Molecular Weight | 344.41500 |
| Exact Mass | 343.91400 |
| PSA | 134.40000 |
| LogP | 6.03760 |
| InChIKey | IUZWHLFZPWVDJZ-UHFFFAOYSA-N |
| SMILES | S=P1(c2ccccc2)SP(=S)(c2ccccc2)S1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 1 | |
CAS#:3497-00-5
CAS#:1486-35-7
CAS#:55499-33-7
CAS#:638-21-1
CAS#:75471-07-7
CAS#:75471-08-8
CAS#:3376-52-1
CAS#:644-97-3
CAS#:824-72-6
CAS#:7783-06-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| phenylphosphonodithioic anhydride |
| Phenylperthiophosphonsaeureanhydrid |
| 2,4-diphenyl-[1,2,3,4]-dithiaphosphetane-2,4-disulfide |
| 1,3,2,4-Dithiadiphosphetane,2,4-diphenyl-,2,4-disulfide |
| bis(phenylphosphonotrithioic) bisthioanhydride |
| Dimeres Phenyldithiophosphonsaeureanhydrid |
| 1,3-Diphenyl-1,3-dithioxo-1,3-diphospha-2,4-dithia-cyclobutan |
| 2,4-diphenyl-cyclodiphosphathiane 2,4-disulfide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane? |
| A: InChIKey of 2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane is IUZWHLFZPWVDJZ-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane? |
| A: Related upstream materials(CAS) of 2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane: 3497-00-5;1486-35-7;55499-33-7;638-21-1;75471-07-7;75471-08-8;3376-52-1;644-97-3;824-72-6;7783-06-4. |
| Q: What is the Chinese name of 1024-07-3? |
| A: Chinese name of 1024-07-3 is 1024-07-3. |
| Q: What is the molecular weight of 2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane? |
| A: Molecular weight of 2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane is 344.41500. |
| Q: What is the English name of 2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane? |
| A: The English name of 2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane is 2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane. |
| Q: What is the LogP of 2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane? |
| A: LogP of 2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane is 6.03760. |
| Q: What are the downstream products of 2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane? |
| A: Related downstream products(CAS) of 2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane: 55499-33-7. |
| Q: What English synonyms does 2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane have? |
| A: English synonyms of 2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane: phenylphosphonodithioic anhydride, Phenylperthiophosphonsaeureanhydrid, 2,4-diphenyl-[1,2,3,4]-dithiaphosphetane-2,4-disulfide, 1,3,2,4-Dithiadiphosphetane,2,4-diphenyl-,2,4-disulfide, bis(phenylphosphonotrithioic) bisthioanhydride, Dimeres Phenyldithiophosphonsaeureanhydrid, 1,3-Diphenyl-1,3-dithioxo-1,3-diphospha-2,4-dithia-cyclobutan, 2,4-diphenyl-cyclodiphosphathiane 2,4-disulfide. |
| Q: What is the CAS number of 2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane? |
| A: CAS number of 2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane is 1024-07-3. |
| Q: What is the SMILES notation of 2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane? |
| A: SMILES notation of 2,4-diphenyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane is S=P1(c2ccccc2)SP(=S)(c2ccccc2)S1. |