Phosphonic acid,P-phenyl-, dibutyl ester structure
|
Common Name | Phosphonic acid,P-phenyl-, dibutyl ester | ||
|---|---|---|---|---|
| CAS Number | 1024-34-6 | Molecular Weight | 270.30400 | |
| Density | 1.04g/cm3 | Boiling Point | 347.6ºC at 760mmHg | |
| Molecular Formula | C14H23O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.7ºC | |
| Name | dibutoxyphosphorylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 347.6ºC at 760mmHg |
| Molecular Formula | C14H23O3P |
| Molecular Weight | 270.30400 |
| Flash Point | 177.7ºC |
| Exact Mass | 270.13800 |
| PSA | 45.34000 |
| LogP | 4.13840 |
| Vapour Pressure | 0.000107mmHg at 25°C |
| Index of Refraction | 1.481 |
| InChIKey | YBBHHAFADNTQHQ-UHFFFAOYSA-N |
| SMILES | CCCCOP(=O)(OCCCC)c1ccccc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2931900090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| Phenyl-phosphonsaeure-dibutylester |
| Dibutoxyphenylphosphine oxide |
| phenyl-phosphonic acid dibutyl ester |
| Phenylphosphonsaeure-di-n-butylester |
| Phenylphosphonic Acid Di-n-butyl Ester |
| Dibutyl phenylphosphonate |
| Phosphonic acid,phenyl-,dibutyl ester |
| Di-n-butyl benzenephosphonate |
| di(n-butyl) phenylphosphonate |