trimethyl-(4-trimethylsilylnaphthalen-1-yl)silane structure
|
Common Name | trimethyl-(4-trimethylsilylnaphthalen-1-yl)silane | ||
|---|---|---|---|---|
| CAS Number | 1024-47-1 | Molecular Weight | 272.53300 | |
| Density | 0.92g/cm3 | Boiling Point | 307.2ºC at 760 mmHg | |
| Molecular Formula | C16H24Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.9ºC | |
| Name | trimethyl-(4-trimethylsilylnaphthalen-1-yl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.92g/cm3 |
|---|---|
| Boiling Point | 307.2ºC at 760 mmHg |
| Molecular Formula | C16H24Si2 |
| Molecular Weight | 272.53300 |
| Flash Point | 122.9ºC |
| Exact Mass | 272.14200 |
| LogP | 3.93020 |
| Vapour Pressure | 0.00133mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | HAHFMUUKMOXSTI-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)c1ccc([Si](C)(C)C)c2ccccc12 |
| HS Code | 2931900090 |
|---|
|
~82%
trimethyl-(4-tr... CAS#:1024-47-1 |
| Literature: Molecules, , vol. 17, # 5 p. 5108 - 5125 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Silane,1,4-naphthalenediylbis(trimethyl |
| 1.4-Bis(trimethylsilyl)naphthalin |
| 1,4-bis(trimethylsilyl)naphthalene |