3,3''-DINITRO-2,2''-DIPYRIDYL structure
|
Common Name | 3,3''-DINITRO-2,2''-DIPYRIDYL | ||
|---|---|---|---|---|
| CAS Number | 1024-94-8 | Molecular Weight | 246.17900 | |
| Density | 1.493g/cm3 | Boiling Point | 396.8ºC at 760mmHg | |
| Molecular Formula | C10H6N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.8ºC | |
| Name | 3-nitro-2-(3-nitropyridin-2-yl)pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.493g/cm3 |
|---|---|
| Boiling Point | 396.8ºC at 760mmHg |
| Molecular Formula | C10H6N4O4 |
| Molecular Weight | 246.17900 |
| Flash Point | 193.8ºC |
| Exact Mass | 246.03900 |
| PSA | 117.42000 |
| LogP | 3.00640 |
| InChIKey | PQSBMZFINXSHDM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccnc1-c1ncccc1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
|
~85%
3,3''-DINITRO-2... CAS#:1024-94-8 |
| Literature: Synthetic Communications, , vol. 27, # 14 p. 2393 - 2402 |
|
~25%
Detail
|
| Literature: Polish Journal of Chemistry, , vol. 66, # 5 p. 801 - 805 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,3'-Dinitro-2,2'-bipyridine |
| 3,3'-dinitro-[2,2']bipyridinyl |
| 3,3'-(NO2)2-bpy |
| 2,2'-Bipyridine,3,3'-dinitro |
| 3,3'-(NO2)2-bipy |
| 3,3'-Dinitro-2,2'-bipyridyl |
| OR9994 |