2-(2-Chloro-6-nitrophenyl)ethan-1-ol
Modify Date: 2026-07-15 17:37:07
2-(2-Chloro-6-nitrophenyl)ethan-1-ol structure
|
Common Name | 2-(2-Chloro-6-nitrophenyl)ethan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 102493-68-5 | Molecular Weight | 201.60700 | |
| Density | 1.404g/cm3 | Boiling Point | 311.4ºC at 760mmHg | |
| Molecular Formula | C8H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.1ºC | |
| Name | 2-(2-chloro-6-nitrophenyl)ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.404g/cm3 |
|---|---|
| Boiling Point | 311.4ºC at 760mmHg |
| Molecular Formula | C8H8ClNO3 |
| Molecular Weight | 201.60700 |
| Flash Point | 142.1ºC |
| Exact Mass | 201.01900 |
| PSA | 66.05000 |
| LogP | 2.30620 |
| Vapour Pressure | 0.000242mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | FLKQZNFLWOPRFX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(Cl)c1CCO |
| HS Code | 2906299090 |
|---|
|
~91%
2-(2-Chloro-6-n... CAS#:102493-68-5 |
| Literature: Tsuji, Yasushi; Kotachi, Shinji; Huh, Keun-Tae; Watanabe, Yoshihisa Journal of Organic Chemistry, 1990 , vol. 55, # 2 p. 580 - 584 |
|
~86%
2-(2-Chloro-6-n... CAS#:102493-68-5 |
| Literature: Wakunaga Seiyaku Kabushiki Kaisha; Fujisawa Pharmaceutical Co., Ltd. Patent: US5254685 A1, 1993 ; |
|
~66%
2-(2-Chloro-6-n... CAS#:102493-68-5 |
| Literature: Pfleiderer; Wolfgang Patent: US5763599 A1, 1998 ; |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
CAS#:41910-64-9
CAS#:100376-53-2
CAS#:102855-24-3
CAS#:25235-85-2
CAS#:118244-93-2| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
Total 1, Current Page 1 of 1
1
| 3-chloro-2-(2-hydroxyethyl)nitrobenzene |
| 2-(6-chloro-2-nitrophenyl)ethan-1-ol |
| 2-(2-chloro-6-nitrophenyl)-ethanol |
| 1-chloro-2-(2-hydroxyethyl)-3-nitrobenzene |
| Benzeneethanol,2-chloro-6-nitro |
| 2-chloro-6-nitro-benzeneethanol |