bromo(3-bromo-1-adamantyl)acetic acid structure
|
Common Name | bromo(3-bromo-1-adamantyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 102516-42-7 | Molecular Weight | 352.06200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bromo(3-bromo-1-adamantyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16Br2O2 |
|---|---|
| Molecular Weight | 352.06200 |
| Exact Mass | 349.95200 |
| PSA | 37.30000 |
| LogP | 3.56840 |
| InChIKey | PKGVWUJFDWNKFJ-UHFFFAOYSA-N |
| SMILES | O=C(O)C(Br)C12CC3CC(CC(Br)(C3)C1)C2 |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| bromo(3-bromo-1-adamantyl)acetic acid |