N,N''-DIBENZYL-MALONAMIDE structure
|
Common Name | N,N''-DIBENZYL-MALONAMIDE | ||
|---|---|---|---|---|
| CAS Number | 10255-99-9 | Molecular Weight | 282.33700 | |
| Density | 1.155g/cm3 | Boiling Point | 595.3ºC at 760mmHg | |
| Molecular Formula | C17H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.1ºC | |
| Name | N,N'-dibenzylpropanediamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.155g/cm3 |
|---|---|
| Boiling Point | 595.3ºC at 760mmHg |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.33700 |
| Flash Point | 232.1ºC |
| Exact Mass | 282.13700 |
| PSA | 65.18000 |
| LogP | 3.68990 |
| Vapour Pressure | 3.89E-14mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | RHHVWHPMKFVUGF-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)NCc1ccccc1)NCc1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-dibenzylmalondiamide |
| n,n'-dibenzylmalonamide |
| malonic acid dibenzylamide |
| F3099-6034 |
| N,N'-Dibenzylmalonediamide |
| Malonsaeuredibenzylamid |
| N1,N3-dibenzylmalonamide |