2-(bis(2-hydroxyethyl)amino)ethanol, 2-(2,4-dichlorophenyl)sulfonylace tic acid structure
|
Common Name | 2-(bis(2-hydroxyethyl)amino)ethanol, 2-(2,4-dichlorophenyl)sulfonylace tic acid | ||
|---|---|---|---|---|
| CAS Number | 102582-96-7 | Molecular Weight | 418.29000 | |
| Density | N/A | Boiling Point | 499.9ºC at 760mmHg | |
| Molecular Formula | C14H21Cl2NO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.1ºC | |
| Name | 2-[bis(2-hydroxyethyl)amino]ethanol,2-(2,4-dichlorophenyl)sulfonylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 499.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C14H21Cl2NO7S |
| Molecular Weight | 418.29000 |
| Flash Point | 256.1ºC |
| Exact Mass | 417.04200 |
| PSA | 143.75000 |
| LogP | 1.19780 |
| Vapour Pressure | 8.2E-11mmHg at 25°C |
| InChIKey | VFLJQTRTWFKESS-UHFFFAOYSA-N |
| SMILES | O=C(O)CS(=O)(=O)c1ccc(Cl)cc1Cl.OCCN(CCO)CCO |
| ((2,4-Dichlorophenyl)sulfonyl)acetic acid compd. with 2,2',2''-nitrilotrisethanol (1:1) |
| [(2,4-dichlorophenyl)sulfonyl]acetic acid-2,2',2''-nitrilotriethanol (1:1) |
| Acetic acid,((2,4-dichlorophenyl)sulfonyl)-,compd. with 2,2',2''-nitrilotrisethanol (1:1) |
| ((2,4-Dichlorophenyl)sulfonyl)acetic acid triethanolamine |
| 2-(2,4-dichlorophenyl)sulfonylacetic acid |