2-(4-chlorophenyl)sulfonylacetic acid,2-(diethylamino)ethanol structure
|
Common Name | 2-(4-chlorophenyl)sulfonylacetic acid,2-(diethylamino)ethanol | ||
|---|---|---|---|---|
| CAS Number | 102582-97-8 | Molecular Weight | 351.84600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22ClNO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-chlorophenyl)sulfonylacetic acid,2-(diethylamino)ethanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H22ClNO5S |
|---|---|
| Molecular Weight | 351.84600 |
| Exact Mass | 351.09100 |
| PSA | 103.29000 |
| LogP | 2.59960 |
| InChIKey | MMXGDPZBRLJGSV-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCO.O=C(O)CS(=O)(=O)c1ccc(Cl)cc1 |
| Acetic acid,((p-chlorophenyl)sulfonyl)-,compd. with 2-(diethylamino)ethanol (1:1) |
| ((p-Chlorophenyl)sulfonyl)acetic acid compd. with 2-(diethylamino)ethanol (1:1) |
| ((p-Chlorophenyl)sulfonyl)acetic acid diethylaminoethanol |