ethyl 2-(2-acetyl-4-chloro-5-methylphenoxy)acetate structure
|
Common Name | ethyl 2-(2-acetyl-4-chloro-5-methylphenoxy)acetate | ||
|---|---|---|---|---|
| CAS Number | 1026-32-0 | Molecular Weight | 270.70900 | |
| Density | 1.196g/cm3 | Boiling Point | 384.8ºC at 760 mmHg | |
| Molecular Formula | C13H15ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.8ºC | |
| Name | ethyl 2-(2-acetyl-4-chloro-5-methylphenoxy)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.196g/cm3 |
|---|---|
| Boiling Point | 384.8ºC at 760 mmHg |
| Molecular Formula | C13H15ClO4 |
| Molecular Weight | 270.70900 |
| Flash Point | 152.8ºC |
| Exact Mass | 270.06600 |
| PSA | 52.60000 |
| LogP | 2.79290 |
| Vapour Pressure | 3.98E-06mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | NIROJEUWLSEEAV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COc1cc(C)c(Cl)cc1C(C)=O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ETHYL 2-(2-ACETYL-4-CHLORO-5-METHYL-PHENOXY)ACETATE |
| (2-acetyl-4-chloro-5-methylphenoxy)acetic acid ethyl ester |
| Acetic acid,2-(2-acetyl-4-chloro-5-methylphenoxy)-,ethyl ester |
| Aethyl-2-acetyl-4-chlor-5-methyl-phenoxyacetat |
| Acetic acid,(6-acetyl-4-chloro-m-tolyloxy)-,ethyl ester |
| (2-Acetyl-4-chlor-5-methyl-phenoxy)essigsaeureaethylester |
| Aceticacid,[(6-acetyl-4-chloro-m-tolyl)oxy]-,ethyl ester (7CI,8CI) |