3-Piperidinecarboxylicacid, 4-oxo-1-phenyl-, ethyl ester, hydrochloride (1:1) structure
|
Common Name | 3-Piperidinecarboxylicacid, 4-oxo-1-phenyl-, ethyl ester, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 1026-47-7 | Molecular Weight | 283.75100 | |
| Density | 1.164g/cm3 | Boiling Point | 383ºC at 760mmHg | |
| Molecular Formula | C14H18ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.4ºC | |
| Name | ethyl 4-oxo-1-phenylpiperidine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 383ºC at 760mmHg |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.75100 |
| Flash Point | 185.4ºC |
| Exact Mass | 283.09800 |
| PSA | 46.61000 |
| LogP | 2.51210 |
| Vapour Pressure | 4.54E-06mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | SRZRBQSYAYJVBD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CN(c2ccccc2)CCC1=O |
| Storage condition | 2-8°C |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-oxo-1-phenyl-piperidine-3-carboxylic acid ethyl ester,hydrochloride |
| ethyl 4-oxo-1-phenyl-3-piperidinecarboxylate hydrochloride |
| 4-Oxo-1-phenyl-piperidin-3-carbonsaeure-aethylester,Hydrochlorid |