[(Z)-6-methylhept-2-en-4-yl] 2-phenylmethoxyacetate structure
|
Common Name | [(Z)-6-methylhept-2-en-4-yl] 2-phenylmethoxyacetate | ||
|---|---|---|---|---|
| CAS Number | 102616-10-4 | Molecular Weight | 276.37100 | |
| Density | 1.004g/cm3 | Boiling Point | 371ºC at 760mmHg | |
| Molecular Formula | C17H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.6ºC | |
| Name | [(Z)-6-methylhept-2-en-4-yl] 2-phenylmethoxyacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.004g/cm3 |
|---|---|
| Boiling Point | 371ºC at 760mmHg |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.37100 |
| Flash Point | 132.6ºC |
| Exact Mass | 276.17300 |
| PSA | 35.53000 |
| LogP | 3.73720 |
| Vapour Pressure | 1.07E-05mmHg at 25°C |
| Index of Refraction | 1.5 |
| InChIKey | UACNCKDWFJZFGU-YWEYNIOJSA-N |
| SMILES | CC=CC(CC(C)C)OC(=O)COCc1ccccc1 |
|
~97%
[(Z)-6-methylhe... CAS#:102616-10-4 |
| Literature: Journal of Organic Chemistry, , vol. 52, # 17 p. 3889 - 3901 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| ((Z)-6-methylhept-2-en-4-yl) 2-phenylmethoxyacetate |
| (Z)-2-methylhept-5-en-4-ol (phenylmethoxy)acetate |