(2E,4R,5R,6R,7E)-6,10-dimethyl-5-phenylmethoxyundeca-2,7-dien-4-ol structure
|
Common Name | (2E,4R,5R,6R,7E)-6,10-dimethyl-5-phenylmethoxyundeca-2,7-dien-4-ol | ||
|---|---|---|---|---|
| CAS Number | 102616-13-7 | Molecular Weight | 302.45100 | |
| Density | 0.966g/cm3 | Boiling Point | 411.4ºC at 760mmHg | |
| Molecular Formula | C20H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163ºC | |
| Name | (2E,4R,5R,6R,7E)-6,10-dimethyl-5-phenylmethoxyundeca-2,7-dien-4-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.966g/cm3 |
|---|---|
| Boiling Point | 411.4ºC at 760mmHg |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.45100 |
| Flash Point | 163ºC |
| Exact Mass | 302.22500 |
| PSA | 29.46000 |
| LogP | 4.74720 |
| Vapour Pressure | 1.67E-07mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | SSMFQVRDMIGKDM-ILTCXOPASA-N |
| SMILES | CC=CC(O)C(OCc1ccccc1)C(C)C=CCC(C)C |
|
~%
(2E,4R,5R,6R,7E... CAS#:102616-13-7 |
| Literature: Journal of Organic Chemistry, , vol. 51, # 14 p. 2855 - 2857 |
|
~%
(2E,4R,5R,6R,7E... CAS#:102616-13-7 |
| Literature: Journal of Organic Chemistry, , vol. 51, # 14 p. 2855 - 2857 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| (2E,7E)-(4R*,5R*,6R*)-6,10-dimethyl-5-(phenylmethoxy)undeca-2,7-dien-4-ol |
| 2,7-Undecadien-4-ol,6,10-dimethyl-5-(phenylmethoxy)-,(2E,4R*,5R*,6R*,7E) |