N-Phenyl-3-(3,4,5-trimethoxyphenyl)propenamide structure
|
Common Name | N-Phenyl-3-(3,4,5-trimethoxyphenyl)propenamide | ||
|---|---|---|---|---|
| CAS Number | 10263-44-2 | Molecular Weight | 313.34800 | |
| Density | 1.189g/cm3 | Boiling Point | 523.6ºC at 760mmHg | |
| Molecular Formula | C18H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.4ºC | |
| Name | (E)-N-phenyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.189g/cm3 |
|---|---|
| Boiling Point | 523.6ºC at 760mmHg |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.34800 |
| Flash Point | 270.4ºC |
| Exact Mass | 313.13100 |
| PSA | 60.28000 |
| LogP | 4.01380 |
| Vapour Pressure | 4.67E-11mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | NAMIBPVVEFIUEE-MDZDMXLPSA-N |
| SMILES | COc1cc(C=CC(=O)Nc2ccccc2)cc(OC)c1OC |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| CINNAMANILIDE,3,4,5-TRIMETHOXY |
| 3,4,5-Trimethoxyzimtsaeure-anilid |
| 3,4,5-Trimethoxycinnamanilide |
| 3.4.5-Trimethoxycinnamanilid |