(4-nitrophenyl)methyl piperidine-1-carboxylate structure
|
Common Name | (4-nitrophenyl)methyl piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 102637-13-8 | Molecular Weight | 264.27700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-nitrophenyl)methyl piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H16N2O4 |
|---|---|
| Molecular Weight | 264.27700 |
| Exact Mass | 264.11100 |
| PSA | 75.36000 |
| LogP | 3.17840 |
| InChIKey | NNSKHHNLVSQOBT-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)N1CCCCC1 |
|
~%
(4-nitrophenyl)... CAS#:102637-13-8 |
| Literature: Maia, Hernani L. S.; Medeiros, Maria-Jose; Montenegro, Maria-Irene; Pletcher, Derek Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1988 , p. 409 - 412 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Piperidinecarboxylic acid,(4-nitrophenyl)methyl ester |