(betaS)-2-Chloro-beta-(1-methoxy-1-methylethoxy)-benzeneethanol 1-Carbamate
Modify Date: 2025-09-18 18:49:06
(betaS)-2-Chloro-beta-(1-methoxy-1-methylethoxy)-benzeneethanol 1-Carbamate structure
|
Common Name | (betaS)-2-Chloro-beta-(1-methoxy-1-methylethoxy)-benzeneethanol 1-Carbamate | ||
|---|---|---|---|---|
| CAS Number | 1026550-57-1 | Molecular Weight | 287.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (betaS)-2-Chloro-beta-(1-methoxy-1-methylethoxy)-benzeneethanol 1-Carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18ClNO4 |
|---|---|
| Molecular Weight | 287.74 |
| InChIKey | IYOQJZBABNPCNT-LLVKDONJSA-N |
| SMILES | COC(C)(C)OC(COC(N)=O)c1ccccc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (betaS)-2-Chloro-beta-(1-methoxy-1-methylethoxy)-benzeneethanol 1-Carbamate? |
| A: Molecular formula of (betaS)-2-Chloro-beta-(1-methoxy-1-methylethoxy)-benzeneethanol 1-Carbamate is C13H18ClNO4. |
| Q: What is the Chinese name of 1026550-57-1? |
| A: Chinese name of 1026550-57-1 is 1026550-57-1. |
| Q: What is the SMILES notation of (betaS)-2-Chloro-beta-(1-methoxy-1-methylethoxy)-benzeneethanol 1-Carbamate? |
| A: SMILES notation of (betaS)-2-Chloro-beta-(1-methoxy-1-methylethoxy)-benzeneethanol 1-Carbamate is COC(C)(C)OC(COC(N)=O)c1ccccc1Cl. |
| Q: What is the molecular weight of (betaS)-2-Chloro-beta-(1-methoxy-1-methylethoxy)-benzeneethanol 1-Carbamate? |
| A: Molecular weight of (betaS)-2-Chloro-beta-(1-methoxy-1-methylethoxy)-benzeneethanol 1-Carbamate is 287.74. |
| Q: What is the CAS number of (betaS)-2-Chloro-beta-(1-methoxy-1-methylethoxy)-benzeneethanol 1-Carbamate? |
| A: CAS number of (betaS)-2-Chloro-beta-(1-methoxy-1-methylethoxy)-benzeneethanol 1-Carbamate is 1026550-57-1. |
| Q: What is the English name of (betaS)-2-Chloro-beta-(1-methoxy-1-methylethoxy)-benzeneethanol 1-Carbamate? |
| A: The English name of (betaS)-2-Chloro-beta-(1-methoxy-1-methylethoxy)-benzeneethanol 1-Carbamate is (betaS)-2-Chloro-beta-(1-methoxy-1-methylethoxy)-benzeneethanol 1-Carbamate. |
| Q: What is the InChIKey of (betaS)-2-Chloro-beta-(1-methoxy-1-methylethoxy)-benzeneethanol 1-Carbamate? |
| A: InChIKey of (betaS)-2-Chloro-beta-(1-methoxy-1-methylethoxy)-benzeneethanol 1-Carbamate is IYOQJZBABNPCNT-LLVKDONJSA-N. |