5-(2-Hydroxyethyl)uridine structure
|
Common Name | 5-(2-Hydroxyethyl)uridine | ||
|---|---|---|---|---|
| CAS Number | 102691-28-1 | Molecular Weight | 288.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5-(2-Hydroxyethyl)uridine5-(2-Hydroxyethyl)uridine is a thymidine analogue. Analogs of this series have insertional activity towards replicated DNA. They can be used to label cells and track DNA synthesis[1]. |
| Name | 5-(2-Hydroxyethyl)uridine |
|---|
| Description | 5-(2-Hydroxyethyl)uridine is a thymidine analogue. Analogs of this series have insertional activity towards replicated DNA. They can be used to label cells and track DNA synthesis[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C11H16N2O7 |
|---|---|
| Molecular Weight | 288.25 |
| InChIKey | OSEOKIRHVJGJJM-FDDDBJFASA-N |
| SMILES | O=c1[nH]c(=O)n(C2OC(CO)C(O)C2O)cc1CCO |