2-Phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoxaline
Modify Date: 2026-08-18 10:33:25
2-Phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoxaline structure
|
Common Name | 2-Phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoxaline | ||
|---|---|---|---|---|
| CAS Number | 102729-49-7 | Molecular Weight | 278.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13F3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoxaline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H13F3N2 |
|---|---|
| Molecular Weight | 278.27 |
| InChIKey | OEVWMTPRMOGVPO-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc2c(c1)NCC(c1ccccc1)N2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-Phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoxaline? |
| A: InChIKey of 2-Phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoxaline is OEVWMTPRMOGVPO-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-Phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoxaline? |
| A: SMILES notation of 2-Phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoxaline is FC(F)(F)c1ccc2c(c1)NCC(c1ccccc1)N2. |
| Q: What is the English name of 2-Phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoxaline? |
| A: The English name of 2-Phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoxaline is 2-Phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoxaline. |
| Q: What is the CAS number of 2-Phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoxaline? |
| A: CAS number of 2-Phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoxaline is 102729-49-7. |
| Q: What is the molecular formula of 2-Phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoxaline? |
| A: Molecular formula of 2-Phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoxaline is C15H13F3N2. |
| Q: What is the Chinese name of 102729-49-7? |
| A: Chinese name of 102729-49-7 is 102729-49-7. |
| Q: What is the molecular weight of 2-Phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoxaline? |
| A: Molecular weight of 2-Phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoxaline is 278.27. |