15-Methyl[3,1]benzimidazo[1',2':1,6]pyridazino[3,4-f][1,10]phenanthrolin-15-ium
Modify Date: 2026-06-19 17:18:24
![15-Methyl[3,1]benzimidazo[1',2':1,6]pyridazino[3,4-f][1,10]phenanthrolin-15-ium Structure](https://www.chemsrc.com/extcaspic/315/1027338-56-2.png)
15-Methyl[3,1]benzimidazo[1',2':1,6]pyridazino[3,4-f][1,10]phenanthrolin-15-ium structure
|
Common Name | 15-Methyl[3,1]benzimidazo[1',2':1,6]pyridazino[3,4-f][1,10]phenanthrolin-15-ium | ||
|---|---|---|---|---|
| CAS Number | 1027338-56-2 | Molecular Weight | 336.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H14N5+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 15-Methyl[3,1]benzimidazo[1',2':1,6]pyridazino[3,4-f][1,10]phenanthrolin-15-ium |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H14N5+ |
|---|---|
| Molecular Weight | 336.4 |
| InChIKey | MWCZRRSNHJFRNO-UHFFFAOYSA-N |
| SMILES | C[N+]1=C2C=C3C4=C(C5=C(C3=NN2C6=CC=CC=C61)C=CC=N5)N=CC=C4 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of PRC2 EZH2 sub unit (unknown origin) assessed as inhibition of SAM-media...
Source: ChEMBL
Target: Histone-lysine N-methyltransferase EZH2
External Id: CHEMBL3826279
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 15-Methyl[3,1]benzimidazo[1',2':1,6]pyridazino[3,4-f][1,10]phenanthrolin-15-ium? |
| A: Molecular weight of 15-Methyl[3,1]benzimidazo[1',2':1,6]pyridazino[3,4-f][1,10]phenanthrolin-15-ium is 336.4. |
| Q: What is the Chinese name of 1027338-56-2? |
| A: Chinese name of 1027338-56-2 is 1027338-56-2. |
| Q: What is the CAS number of 15-Methyl[3,1]benzimidazo[1',2':1,6]pyridazino[3,4-f][1,10]phenanthrolin-15-ium? |
| A: CAS number of 15-Methyl[3,1]benzimidazo[1',2':1,6]pyridazino[3,4-f][1,10]phenanthrolin-15-ium is 1027338-56-2. |
| Q: What is the English name of 15-Methyl[3,1]benzimidazo[1',2':1,6]pyridazino[3,4-f][1,10]phenanthrolin-15-ium? |
| A: The English name of 15-Methyl[3,1]benzimidazo[1',2':1,6]pyridazino[3,4-f][1,10]phenanthrolin-15-ium is 15-Methyl[3,1]benzimidazo[1',2':1,6]pyridazino[3,4-f][1,10]phenanthrolin-15-ium. |
| Q: What is the molecular formula of 15-Methyl[3,1]benzimidazo[1',2':1,6]pyridazino[3,4-f][1,10]phenanthrolin-15-ium? |
| A: Molecular formula of 15-Methyl[3,1]benzimidazo[1',2':1,6]pyridazino[3,4-f][1,10]phenanthrolin-15-ium is C21H14N5+. |
| Q: What is the SMILES notation of 15-Methyl[3,1]benzimidazo[1',2':1,6]pyridazino[3,4-f][1,10]phenanthrolin-15-ium? |
| A: SMILES notation of 15-Methyl[3,1]benzimidazo[1',2':1,6]pyridazino[3,4-f][1,10]phenanthrolin-15-ium is C[N+]1=C2C=C3C4=C(C5=C(C3=NN2C6=CC=CC=C61)C=CC=N5)N=CC=C4. |
| Q: What is the InChIKey of 15-Methyl[3,1]benzimidazo[1',2':1,6]pyridazino[3,4-f][1,10]phenanthrolin-15-ium? |
| A: InChIKey of 15-Methyl[3,1]benzimidazo[1',2':1,6]pyridazino[3,4-f][1,10]phenanthrolin-15-ium is MWCZRRSNHJFRNO-UHFFFAOYSA-N. |