4-fluoro-3-(trifluoromethylsulfonyl)benzenesulfonyl chloride structure
|
Common Name | 4-fluoro-3-(trifluoromethylsulfonyl)benzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 1027345-07-8 | Molecular Weight | 326.67300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H3ClF4O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-fluoro-3-(trifluoromethylsulfonyl)benzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H3ClF4O4S2 |
|---|---|
| Molecular Weight | 326.67300 |
| Exact Mass | 325.91000 |
| PSA | 85.04000 |
| LogP | 4.20830 |
| InChIKey | SYZOKHJRIIDLOQ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc(F)c(S(=O)(=O)C(F)(F)F)c1 |
| HS Code | 2904909090 |
|---|
|
~61%
4-fluoro-3-(tri... CAS#:1027345-07-8 |
| Literature: GENENTECH, INC.; WALTER AND ELIZA HALL INSTITUTE OF MEDICAL RESEARCH Patent: WO2008/61208 A2, 2008 ; Location in patent: Page/Page column 30-31 ; WO 2008/061208 A2 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD16883063 |