6-(BROMOMETHYL)-4'-CHLORO-4,4-DIMETHYL-2,3,4,5-TETRAHYDRO-1,1'-BIPHENYL structure
|
Common Name | 6-(BROMOMETHYL)-4'-CHLORO-4,4-DIMETHYL-2,3,4,5-TETRAHYDRO-1,1'-BIPHENYL | ||
|---|---|---|---|---|
| CAS Number | 1027345-22-7 | Molecular Weight | 313.66000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18BrCl | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[2-(bromomethyl)-4,4-dimethylcyclohexen-1-yl]-4-chlorobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H18BrCl |
|---|---|
| Molecular Weight | 313.66000 |
| Exact Mass | 312.02800 |
| LogP | 5.69860 |
| InChIKey | XNGITAHSHNGSFS-UHFFFAOYSA-N |
| SMILES | CC1(C)CCC(c2ccc(Cl)cc2)=C(CBr)C1 |
| HS Code | 2903999090 |
|---|
|
~95%
6-(BROMOMETHYL)... CAS#:1027345-22-7 |
| Literature: GENENTECH, INC.; THE WALTER AND ELIZA HALL INSTITUTE OF MEDICAL RESEARCH Patent: WO2009/143246 A2, 2009 ; Location in patent: Page/Page column 211; 212 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-(2-bromomethyl-4,4-dimethyl-cyclohex-1-enyl)-4-chloro-benzene |
| 1-(2-bromomethyl-4,4-dimethyl-cyclohex-1-en-1-yl)-4-chloro-benzene |
| 6-(Bromomethyl)-4'-chloro-4,4-dimethyl-2,3,4,5-tetrahydro-1,1'-biphenyl |