Ethyl 3-benzoyl-2-phenyl-1-indolizinecarboxylate structure
|
Common Name | Ethyl 3-benzoyl-2-phenyl-1-indolizinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 102767-46-4 | Molecular Weight | 369.413 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C24H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3-benzoyl-2-phenylindolizine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C24H19NO3 |
| Molecular Weight | 369.413 |
| Exact Mass | 369.136505 |
| PSA | 47.78000 |
| LogP | 5.93 |
| Index of Refraction | 1.613 |
| InChIKey | LAGZFCDMCPBYEB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(-c2ccccc2)c(C(=O)c2ccccc2)n2ccccc12 |
|
~46%
Ethyl 3-benzoyl... CAS#:102767-46-4 |
| Literature: Nugent, Richard A.; Murphy, Megan Journal of Organic Chemistry, 1987 , vol. 52, # 11 p. 2206 - 2208 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Indolizinecarboxylic acid,3-benzoyl-2-phenyl-,ethyl ester |
| 1-Indolizinecarboxylic acid, 3-benzoyl-2-phenyl-, ethyl ester |
| Ethyl 3-benzoyl-2-phenyl-1-indolizinecarboxylate |