2-(Bis(2-hydroxyethyl)amino)ethyl oleate structure
|
Common Name | 2-(Bis(2-hydroxyethyl)amino)ethyl oleate | ||
|---|---|---|---|---|
| CAS Number | 10277-04-0 | Molecular Weight | 413.634 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 528.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C24H47NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.6±27.3 °C | |
| Name | 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 528.7±40.0 °C at 760 mmHg |
| Molecular Formula | C24H47NO4 |
| Molecular Weight | 413.634 |
| Flash Point | 273.6±27.3 °C |
| Exact Mass | 413.350494 |
| PSA | 70.00000 |
| LogP | 7.53 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.487 |
| InChIKey | FTJUZCBLWZLXFR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCCN(CCO)CCO |
| HS Code | 2916150000 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 233-621-2 |
| triethanolamine monooleate ester |
| 9-Octadecenoic acid (9Z)-,2-(bis(2-hydroxyethyl)amino)ethyl ester |
| 2-[Bis(2-hydroxyethyl)amino]ethyl (9Z)-9-octadecenoate |
| Triethanolamine,oleic acid monoester |
| 9-Octadecenoic acid, 2-[bis(2-hydroxyethyl)amino]ethyl ester, (9Z)- |
| 2-(Bis(2-hydroxyethyl)amino)ethyl oleate |
| 9-Octadecenoic acid,(Z)-,2-(bis(2-hydroxyethyl)amino)ethyl ester |
| 2-[Bis(2-hydroxyethyl)amino]ethyl (9Z)-octadec-9-enoate |