Carbonic acid tert-butyl ester 3-formyl-4-nitro-phenyl ester structure
|
Common Name | Carbonic acid tert-butyl ester 3-formyl-4-nitro-phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 1027818-09-2 | Molecular Weight | 267.23500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl (3-formyl-4-nitrophenyl) carbonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13NO6 |
|---|---|
| Molecular Weight | 267.23500 |
| Exact Mass | 267.07400 |
| PSA | 98.42000 |
| LogP | 3.24440 |
| InChIKey | OMIJQVZABUOFPB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Oc1ccc([N+](=O)[O-])c(C=O)c1 |
| HS Code | 2920909090 |
|---|
|
~90%
Carbonic acid t... CAS#:1027818-09-2 |
| Literature: Wadsworth, Alan H.; Lawrie, Kenneth W. M. Journal of Labelled Compounds and Radiopharmaceuticals, 2007 , vol. 50, # 5-6 p. 526 - 527 |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Carbonic acid tert-butyl ester 3-formyl-4-nitro-phenyl ester |