1-nitro-5H-phenanthro(4,5-bcd)pyran-5-one
1-nitro-5H-phenanthro(4,5-bcd)pyran-5-one structure
|
Common Name | 1-nitro-5H-phenanthro(4,5-bcd)pyran-5-one | ||
|---|---|---|---|---|
| CAS Number | 102791-33-3 | Molecular Weight | 265.22000 | |
| Density | 1.574g/cm3 | Boiling Point | 518.1ºC at 760 mmHg | |
| Molecular Formula | C15H7NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Nitro-5H-phenanthro<4,5-bcd>pyran-5-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.574g/cm3 |
|---|---|
| Boiling Point | 518.1ºC at 760 mmHg |
| Molecular Formula | C15H7NO4 |
| Molecular Weight | 265.22000 |
| Flash Point | 254.6ºC |
| Exact Mass | 265.03800 |
| PSA | 76.03000 |
| LogP | 3.96860 |
| Vapour Pressure | 7.69E-11mmHg at 25°C |
| Index of Refraction | 1.817 |
| InChIKey | WAKRBKMZTCRERT-UHFFFAOYSA-N |
| SMILES | O=c1oc2ccc([N+](=O)[O-])c3ccc4cccc1c4c23 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~90%
1-nitro-5H-phen... CAS#:102791-33-3 |
| Literature: Abdel-Baky, Samy; Sotiriou-Leventis, Chariklia; Giese, Roger W. Tetrahedron, 1991 , vol. 47, # 30 p. 5667 - 5672 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-Nitro-5H-phenanthro<4,5-bcd>pyran-5-one? |
| A: Molecular formula of 1-Nitro-5H-phenanthropyran-5-one is C15H7NO4. |
| Q: What is the CAS number of 1-Nitro-5H-phenanthro<4,5-bcd>pyran-5-one? |
| A: CAS number of 1-Nitro-5H-phenanthropyran-5-one is 102791-33-3. |
| Q: What is the molecular weight of 1-Nitro-5H-phenanthro<4,5-bcd>pyran-5-one? |
| A: Molecular weight of 1-Nitro-5H-phenanthropyran-5-one is 265.22000. |
| Q: What is the SMILES notation of 1-Nitro-5H-phenanthro<4,5-bcd>pyran-5-one? |
| A: SMILES notation of 1-Nitro-5H-phenanthropyran-5-one is O=c1oc2ccc([N+](=O)[O-])c3ccc4cccc1c4c23. |
| Q: What is the InChIKey of 1-Nitro-5H-phenanthro<4,5-bcd>pyran-5-one? |
| A: InChIKey of 1-Nitro-5H-phenanthropyran-5-one is WAKRBKMZTCRERT-UHFFFAOYSA-N. |
| Q: What is the LogP of 1-Nitro-5H-phenanthro<4,5-bcd>pyran-5-one? |
| A: LogP of 1-Nitro-5H-phenanthropyran-5-one is 3.96860. |
| Q: What is the Chinese name of 102791-33-3? |
| A: Chinese name of 102791-33-3 is 102791-33-3. |
| Q: What is the English name of 1-Nitro-5H-phenanthro<4,5-bcd>pyran-5-one? |
| A: The English name of 1-Nitro-5H-phenanthropyran-5-one is 1-Nitro-5H-phenanthropyran-5-one. |
| Q: What is the polar surface area (PSA) of 1-Nitro-5H-phenanthro<4,5-bcd>pyran-5-one? |
| A: Polar surface area (PSA) of 1-Nitro-5H-phenanthropyran-5-one is 76.03000. |
| Q: What is the boiling point of 1-Nitro-5H-phenanthro<4,5-bcd>pyran-5-one? |
| A: Boiling point of 1-Nitro-5H-phenanthropyran-5-one is 518.1ºC at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |