4-[2-(Dipropylamino)ethyl]-1H-indole-2,3-dione structure
|
Common Name | 4-[2-(Dipropylamino)ethyl]-1H-indole-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 102842-51-3 | Molecular Weight | 274.358 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2-(Dipropylamino)ethyl)indoline-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.358 |
| Exact Mass | 274.168121 |
| PSA | 49.41000 |
| LogP | 2.60 |
| Index of Refraction | 1.549 |
| InChIKey | VBMMNCUKXRDGAZ-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)CCc1cccc2c1C(=O)C(=O)N2 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-[2-(Dipropylamino)ethyl]-1H-indole-2,3-dione |
| 1H-Indole-2,3-dione, 4-[2-(dipropylamino)ethyl]- |