4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride
Modify Date: 2026-07-08 21:59:51
![4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride Structure](https://image.chemsrc.com/caspic/468/1028486-08-9.png)
4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride structure
|
Common Name | 4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1028486-08-9 | Molecular Weight | 245.66300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H12ClN3O3 |
|---|---|
| Molecular Weight | 245.66300 |
| Exact Mass | 245.05700 |
| PSA | 108.43000 |
| LogP | 2.37380 |
| InChIKey | UAUPRRDMUGWWJX-UHFFFAOYSA-N |
| SMILES | COc1cc(N=C(N)N)ccc1C(=O)O.Cl |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-{[ammo(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride? |
| A: InChIKey of 4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride is UAUPRRDMUGWWJX-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride? |
| A: Molecular formula of 4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride is C9H12ClN3O3. |
| Q: What is the polar surface area (PSA) of 4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride? |
| A: Polar surface area (PSA) of 4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride is 108.43000. |
| Q: What is the English name of 4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride? |
| A: The English name of 4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride is 4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride. |
| Q: What is the LogP of 4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride? |
| A: LogP of 4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride is 2.37380. |
| Q: What is the CAS number of 4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride? |
| A: CAS number of 4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride is 1028486-08-9. |
| Q: What is the SMILES notation of 4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride? |
| A: SMILES notation of 4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride is COc1cc(N=C(N)N)ccc1C(=O)O.Cl. |
| Q: What English synonyms does 4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride have? |
| A: English synonyms of 4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride: 4-{[ammo(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride. |
| Q: What is the molecular weight of 4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride? |
| A: Molecular weight of 4-{[amino(imino)methyl]amino}-2-methoxybenzoic acid hydrochloride is 245.66300. |
| Q: What is the Chinese name of 1028486-08-9? |
| A: Chinese name of 1028486-08-9 is 1028486-08-9. |