1,5-Hexanedione, 1,2,3-triphenyl-, (R*,S*)
Modify Date: 2025-08-23 00:21:38
1,5-Hexanedione, 1,2,3-triphenyl-, (R*,S*) structure
|
Common Name | 1,5-Hexanedione, 1,2,3-triphenyl-, (R*,S*) | ||
|---|---|---|---|---|
| CAS Number | 10285-13-9 | Molecular Weight | 342.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,5-Hexanedione, 1,2,3-triphenyl-, (R*,S*) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H22O2 |
|---|---|
| Molecular Weight | 342.4 |
| InChIKey | ZDFUVSBUEKPHLC-PKTZIBPZSA-N |
| SMILES | CC(=O)CC(c1ccccc1)C(C(=O)c1ccccc1)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,5-Hexanedione, 1,2,3-triphenyl-, (R*,S*)? |
| A: Molecular weight of 1,5-Hexanedione, 1,2,3-triphenyl-, (R*,S*) is 342.4. |
| Q: What is the Chinese name of 10285-13-9? |
| A: Chinese name of 10285-13-9 is 10285-13-9. |
| Q: What is the SMILES notation of 1,5-Hexanedione, 1,2,3-triphenyl-, (R*,S*)? |
| A: SMILES notation of 1,5-Hexanedione, 1,2,3-triphenyl-, (R*,S*) is CC(=O)CC(c1ccccc1)C(C(=O)c1ccccc1)c1ccccc1. |
| Q: What is the InChIKey of 1,5-Hexanedione, 1,2,3-triphenyl-, (R*,S*)? |
| A: InChIKey of 1,5-Hexanedione, 1,2,3-triphenyl-, (R*,S*) is ZDFUVSBUEKPHLC-PKTZIBPZSA-N. |
| Q: What is the CAS number of 1,5-Hexanedione, 1,2,3-triphenyl-, (R*,S*)? |
| A: CAS number of 1,5-Hexanedione, 1,2,3-triphenyl-, (R*,S*) is 10285-13-9. |
| Q: What is the English name of 1,5-Hexanedione, 1,2,3-triphenyl-, (R*,S*)? |
| A: The English name of 1,5-Hexanedione, 1,2,3-triphenyl-, (R*,S*) is 1,5-Hexanedione, 1,2,3-triphenyl-, (R*,S*). |
| Q: What is the molecular formula of 1,5-Hexanedione, 1,2,3-triphenyl-, (R*,S*)? |
| A: Molecular formula of 1,5-Hexanedione, 1,2,3-triphenyl-, (R*,S*) is C24H22O2. |