N-(2-nitro-naphthalen-4-yl)-acetamide structure
|
Common Name | N-(2-nitro-naphthalen-4-yl)-acetamide | ||
|---|---|---|---|---|
| CAS Number | 102877-08-7 | Molecular Weight | 230.21900 | |
| Density | 1.366g/cm3 | Boiling Point | 477.5ºC at 760 mmHg | |
| Molecular Formula | C12H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.6ºC | |
| Name | N-(3-nitronaphthalen-1-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.366g/cm3 |
|---|---|
| Boiling Point | 477.5ºC at 760 mmHg |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.21900 |
| Flash Point | 242.6ºC |
| Exact Mass | 230.06900 |
| PSA | 78.41000 |
| LogP | 3.87910 |
| Vapour Pressure | 2.8E-09mmHg at 25°C |
| Index of Refraction | 1.697 |
| InChIKey | MQLMDPUDIBLYMT-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc([N+](=O)[O-])cc2ccccc12 |
| HS Code | 2924299090 |
|---|
|
~%
N-(2-nitro-naph... CAS#:102877-08-7 |
| Literature: Vesely; Dvorak Bulletin de la Societe Chimique de France, 1923 , vol. <4> 33, p. 330 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-Acetamido-3-nitronaphthalin |
| N-(2-Nitronaphthalen-4-yl)acetamide |
| N-Acetyl-3-nitro-naphthylamin-(1) |
| N-(3-nitro-[1]naphthyl)-acetamide |
| 1-Acetamido-3-nitronaphthalene |
| 3-Nitro-1-acetamino-naphthalin |