N-(4-Methoxyphenyl)-2-(methylamino)benzamide structure
|
Common Name | N-(4-Methoxyphenyl)-2-(methylamino)benzamide | ||
|---|---|---|---|---|
| CAS Number | 1029-08-9 | Molecular Weight | 256.30000 | |
| Density | 1.21g/cm3 | Boiling Point | 359.6ºC at 760mmHg | |
| Molecular Formula | C15H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.3ºC | |
| Name | N-(4-Methoxyphenyl)-2-(methylamino)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 359.6ºC at 760mmHg |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30000 |
| Flash Point | 171.3ºC |
| Exact Mass | 256.12100 |
| PSA | 50.36000 |
| LogP | 3.13520 |
| Vapour Pressure | 2.35E-05mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | ZYHZFRUUEAWJIS-UHFFFAOYSA-N |
| SMILES | CNc1ccccc1C(=O)Nc1ccc(OC)cc1 |
| HS Code | 2924299090 |
|---|
|
~70%
N-(4-Methoxyphe... CAS#:1029-08-9 |
| Literature: Correa, Arkaitz; Tellitu, Imanol; Dominguez, Esther; SanMartin, Raul Journal of Organic Chemistry, 2006 , vol. 71, # 9 p. 3501 - 3505 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| <N-Methyl-anthranilsaeure>-(4-methoxy-anilid) |
| N-(4-methoxyphenyl)-2-methylaminobenzamide |
| 2-Methylamino-1-(4-methoxy-phenylcarbamoyl)-benzol |
| 2-Methylamino-benzoesaeure-<4-methoxy-phenylamid> |