3-chloropropyl 3,4,5-trimethoxybenzoate structure
|
Common Name | 3-chloropropyl 3,4,5-trimethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 1029-24-9 | Molecular Weight | 288.72400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-chloropropyl 3,4,5-trimethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H17ClO5 |
|---|---|
| Molecular Weight | 288.72400 |
| Exact Mass | 288.07600 |
| PSA | 53.99000 |
| LogP | 2.49810 |
| InChIKey | LCAUMHWMXSOPCJ-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)OCCCCl)cc(OC)c1OC |
| HS Code | 2918990090 |
|---|
|
~%
3-chloropropyl ... CAS#:1029-24-9 |
| Literature: Schloegl,K.; Schloegl,R. Monatshefte fuer Chemie, 1964 , vol. 95, p. 922 - 941 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid,3,4,5-trimethoxy-,3-chloropropyl ester |
| 3,4,5-Trimethoxy-benzoesaeure-<3-chlor-propylester> |
| 3,4,5-trimethoxy-benzoic acid-(3-chloro-propyl ester) |