7-Fluoro-6-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester
Modify Date: 2026-09-28 15:44:42
![7-Fluoro-6-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester Structure](https://www.chemsrc.com/extcaspic/334/1029720-34-0.png)
7-Fluoro-6-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester structure
|
Common Name | 7-Fluoro-6-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 1029720-34-0 | Molecular Weight | 224.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9FO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-Fluoro-6-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H9FO2S |
|---|---|
| Molecular Weight | 224.25 |
| InChIKey | CJHJAADHCLSWGJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2ccc(C)c(F)c2s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 7-Fluoro-6-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester? |
| A: InChIKey of 7-Fluoro-6-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester is CJHJAADHCLSWGJ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1029720-34-0? |
| A: Chinese name of 1029720-34-0 is 1029720-34-0. |
| Q: What is the CAS number of 7-Fluoro-6-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester? |
| A: CAS number of 7-Fluoro-6-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester is 1029720-34-0. |
| Q: What is the molecular formula of 7-Fluoro-6-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester? |
| A: Molecular formula of 7-Fluoro-6-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester is C11H9FO2S. |
| Q: What is the molecular weight of 7-Fluoro-6-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester? |
| A: Molecular weight of 7-Fluoro-6-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester is 224.25. |
| Q: What is the SMILES notation of 7-Fluoro-6-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester? |
| A: SMILES notation of 7-Fluoro-6-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester is COC(=O)c1cc2ccc(C)c(F)c2s1. |
| Q: What is the English name of 7-Fluoro-6-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester? |
| A: The English name of 7-Fluoro-6-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester is 7-Fluoro-6-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester. |