3-(diethylaminomethyl)-2-methyl-1H-quinolin-4-one structure
|
Common Name | 3-(diethylaminomethyl)-2-methyl-1H-quinolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 10299-17-9 | Molecular Weight | 244.33200 | |
| Density | 1.051g/cm3 | Boiling Point | 349.5ºC at 760 mmHg | |
| Molecular Formula | C15H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.2ºC | |
| Name | 3-(diethylaminomethyl)-2-methyl-1H-quinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.051g/cm3 |
|---|---|
| Boiling Point | 349.5ºC at 760 mmHg |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.33200 |
| Flash Point | 165.2ºC |
| Exact Mass | 244.15800 |
| PSA | 36.36000 |
| LogP | 3.09060 |
| Vapour Pressure | 4.68E-05mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | OJQZKRYTKCRNDY-UHFFFAOYSA-N |
| SMILES | CCN(CC)Cc1c(C)[nH]c2ccccc2c1=O |
|
~85%
3-(diethylamino... CAS#:10299-17-9 |
| Literature: Ibrahim, E. S.; Badawi, M. El; Amen, M. A.; Mostafa, M. A. Egyptian Journal of Chemistry, 1994 , vol. 37, # 2 p. 197 - 205 |
| 3-diethylaminomethyl-2-methyl-quinolin-4-ol |
| 3-Diaethylaminomethyl-2-methyl-chinolin-4-ol |