Artefenomel structure
|
Common Name | Artefenomel | ||
|---|---|---|---|---|
| CAS Number | 1029939-86-3 | Molecular Weight | 469.61300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H39NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ArtefenomelArtefenomel (OZ439) is a synthetic antimalarial agent with the artemisinin pharmacophore. Artefenomel (OZ439) is a long-acting artemisinin-related agent[1]. |
| Name | Artefonomel |
|---|
| Description | Artefenomel (OZ439) is a synthetic antimalarial agent with the artemisinin pharmacophore. Artefenomel (OZ439) is a long-acting artemisinin-related agent[1]. |
|---|---|
| Related Catalog | |
| References |
[2]. Rosenthal PJ. Artefenomel: a promising new antimalarial drug. Lancet Infect Dis. 2016 Jan;16(1):6-8. |
| Molecular Formula | C28H39NO5 |
|---|---|
| Molecular Weight | 469.61300 |
| Exact Mass | 469.28300 |
| PSA | 49.39000 |
| LogP | 4.82020 |
| InChIKey | XLCNVWUKICLURR-UHFFFAOYSA-N |
| SMILES | c1cc(C2CCC3(CC2)OOC2(O3)C3CC4CC(C3)CC2C4)ccc1OCCN1CCOCC1 |