5-(furan-2-yl)-1H-1,6-naphthyridin-2-one structure
|
Common Name | 5-(furan-2-yl)-1H-1,6-naphthyridin-2-one | ||
|---|---|---|---|---|
| CAS Number | 102995-76-6 | Molecular Weight | 212.20400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(furan-2-yl)-1H-1,6-naphthyridin-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8N2O2 |
|---|---|
| Molecular Weight | 212.20400 |
| Exact Mass | 212.05900 |
| PSA | 59.15000 |
| LogP | 2.59540 |
| InChIKey | JTCFIMFXVOHMDX-UHFFFAOYSA-N |
| SMILES | O=c1ccc2c(-c3ccco3)nccc2[nH]1 |
|
~88%
5-(furan-2-yl)-... CAS#:102995-76-6 |
| Literature: Singh, Baldev; Lesher, George Y. Journal of Heterocyclic Chemistry, 1990 , vol. 27, # 7 p. 2085 - 2091 |
|
~%
5-(furan-2-yl)-... CAS#:102995-76-6 |
| Literature: Singh, Baldev; Lesher, George Y. Journal of Heterocyclic Chemistry, 1990 , vol. 27, # 7 p. 2085 - 2091 |
|
~%
5-(furan-2-yl)-... CAS#:102995-76-6 |
| Literature: Singh, Baldev; Lesher, George Y. Journal of Heterocyclic Chemistry, 1990 , vol. 27, # 7 p. 2085 - 2091 |
|
~%
5-(furan-2-yl)-... CAS#:102995-76-6 |
| Literature: Singh, Baldev; Lesher, George Y. Journal of Heterocyclic Chemistry, 1990 , vol. 27, # 7 p. 2085 - 2091 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: In vitro inhibition of cAMP PDE III by the compound at a concentration of 10 uM
Source: ChEMBL
Target: cGMP-inhibited 3',5'-cyclic phosphodiesterase B
External Id: CHEMBL824590
|
|
Name: In vitro inhibitory activity against cAMP PDE III.
Source: ChEMBL
Target: cGMP-inhibited 3',5'-cyclic phosphodiesterase B
External Id: CHEMBL824588
|
| 5-(2-furanyl)-1,6-naphthyridin-2(1H)-one |
| 1,6-Naphthyridin-2(1H)-one,5-(2-furanyl) |