2-Propen-1-one,3-[4-(dimethylamino)phenyl]-1-phenyl- structure
|
Common Name | 2-Propen-1-one,3-[4-(dimethylamino)phenyl]-1-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 1030-27-9 | Molecular Weight | 251.32300 | |
| Density | 1.103 g/cm3 | Boiling Point | 415.8ºC at 760 mmHg | |
| Molecular Formula | C17H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.3ºC | |
| Name | 4-(dimethylamino)chalcone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.103 g/cm3 |
|---|---|
| Boiling Point | 415.8ºC at 760 mmHg |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.32300 |
| Flash Point | 161.3ºC |
| Exact Mass | 251.13100 |
| PSA | 20.31000 |
| LogP | 3.64870 |
| Vapour Pressure | 4.02E-07mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | PDKPRWFMRVBCOB-JLHYYAGUSA-N |
| SMILES | CN(C)c1ccc(C=CC(=O)c2ccccc2)cc1 |
| HS Code | 2922399090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-(4-N,N-dimethylaminophenyl)-1-phenyl-2-propen-1-one |
| 2-Propen-1-one,3-(4-(dimethylamino)phenyl)-1-phenyl-(9ci) |
| 3-(4-dimethylaminophenyl)-1-phenylprop-2-en-1-one |
| 3-(4-dimethylaminophenyl)-1-phenyl-propenone |
| 4-(N,N-dimethylamino)benzylideneacetophenone |
| dimethylaminochalcone |
| Chalcone,4-(dimethylamino)-(8ci) |
| 4-(Dimethylamino)benzalacetophenone |
| 4-dimethylaminostyryl phenyl ketone |