Perchloric acid compound with 17-oxa-5lambda~5~-azatrispiro[3.0.4.1.5.1]heptadecane (1:1) structure
|
Common Name | Perchloric acid compound with 17-oxa-5lambda~5~-azatrispiro[3.0.4.1.5.1]heptadecane (1:1) | ||
|---|---|---|---|---|
| CAS Number | 1030-96-2 | Molecular Weight | 335.82400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H26ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 17-oxa-5-azoniatrispiro[3.0.4^{5}.1.5^{11}.1^{4}]heptadecane,perchlorate |
|---|
| Molecular Formula | C15H26ClNO5 |
|---|---|
| Molecular Weight | 335.82400 |
| Exact Mass | 335.15000 |
| PSA | 83.50000 |
| LogP | 3.38340 |
| InChIKey | RBVSVGNFYOTMCC-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)C[N+]1(CCCC1)C1(CCC1)O2 |