2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one
2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one structure
|
Common Name | 2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one | ||
|---|---|---|---|---|
| CAS Number | 103003-37-8 | Molecular Weight | 244.40400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one, CAS Registry Number 103003-37-8, molecular formula C15H20OSi, molecular weight 244.40400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H20OSi |
|---|---|
| Molecular Weight | 244.40400 |
| Exact Mass | 244.12800 |
| PSA | 17.07000 |
| LogP | 3.25030 |
| InChIKey | PXEXRKYATMGFMG-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CCCCc1cccccc1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-(5-trimethyls... CAS#:103003-37-8 |
| Literature: Rigby, James H.; Kirova, Margarita; Niyaz, Noormohamed; Mohammadi, Farahnaz Synlett, 1997 , vol. 1997, # 7 p. 805 - 806 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,4,6-Cycloheptatrien-1-one,2-[5-(trimethylsilyl)-4-pentynyl] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one? |
| A: CAS number of 2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one is 103003-37-8. |
| Q: What is the InChIKey of 2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one? |
| A: InChIKey of 2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one is PXEXRKYATMGFMG-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one? |
| A: Related upstream materials(CAS) of 2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one: 3839-48-3. |
| Q: What is the molecular weight of 2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one? |
| A: Molecular weight of 2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one is 244.40400. |
| Q: What is the molecular formula of 2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one? |
| A: Molecular formula of 2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one is C15H20OSi. |
| Q: What is the English name of 2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one? |
| A: The English name of 2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one is 2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one. |
| Q: What is the LogP of 2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one? |
| A: LogP of 2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one is 3.25030. |
| Q: What is the polar surface area (PSA) of 2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one? |
| A: Polar surface area (PSA) of 2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one is 17.07000. |
| Q: What is the Chinese name of 103003-37-8? |
| A: Chinese name of 103003-37-8 is 103003-37-8. |
| Q: What is the SMILES notation of 2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one? |
| A: SMILES notation of 2-(5-trimethylsilylpent-4-ynyl)cyclohepta-2,4,6-trien-1-one is C[Si](C)(C)C#CCCCc1cccccc1=O. |