TIVICICLOVIR structure
|
Common Name | TIVICICLOVIR | ||
|---|---|---|---|---|
| CAS Number | 103024-93-7 | Molecular Weight | 239.23100 | |
| Density | 1.78g/cm3 | Boiling Point | 667.1ºC at 760 mmHg | |
| Molecular Formula | C9H13N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 357.3ºC | |
Use of TIVICICLOVIRTiviciclovir (AM188) is an antiviral guanosine analog and a hepatitis B virus inhibitor[1]. |
| Name | 2-amino-9-[3-hydroxy-2-(hydroxymethyl)propyl]-3H-purin-6-one |
|---|---|
| Synonym | More Synonyms |
| Description | Tiviciclovir (AM188) is an antiviral guanosine analog and a hepatitis B virus inhibitor[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.78g/cm3 |
|---|---|
| Boiling Point | 667.1ºC at 760 mmHg |
| Molecular Formula | C9H13N5O3 |
| Molecular Weight | 239.23100 |
| Flash Point | 357.3ºC |
| Exact Mass | 239.10200 |
| PSA | 131.04000 |
| Vapour Pressure | 1.04E-18mmHg at 25°C |
| Index of Refraction | 1.784 |
| InChIKey | ANFNNSIOGODJDN-UHFFFAOYSA-N |
| SMILES | Nc1nc2c(ncn2CC(CO)CO)c(=O)[nH]1 |
|
~52%
TIVICICLOVIR CAS#:103024-93-7 |
| Literature: Guillarme, Stephane; Legoupy, Stephanie; Aubertin, Anne-Marie; Olicard, Cecile; Bourgougnon, Nathalie; Huet, Francois Tetrahedron, 2003 , vol. 59, # 12 p. 2177 - 2184 |
|
~74%
TIVICICLOVIR CAS#:103024-93-7 |
| Literature: Martin; McGee; Jeffrey; Hobbs; Smee; Matthews; Verheyden Journal of Medicinal Chemistry, 1986 , vol. 29, # 8 p. 1384 - 1389 |
|
~%
TIVICICLOVIR CAS#:103024-93-7 |
| Literature: Guillarme, Stephane; Legoupy, Stephanie; Aubertin, Anne-Marie; Olicard, Cecile; Bourgougnon, Nathalie; Huet, Francois Tetrahedron, 2003 , vol. 59, # 12 p. 2177 - 2184 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Tiviciclovir |
| Tiviciclovir [INN] |
| 9-[3-hydroxy-2-(hydroxymethyl)prop-1-yl]guanine |
| 2-(guanin-9-ylmethyl)propane-1,3-diol |
| 6H-Purin-6-one,2-amino-1,9-dihydro-9-[3-hydroxy-2-(hydroxymethyl)propyl] |
| AM 188 |