2-Amino-5-chloroaphthalene structure
|
Common Name | 2-Amino-5-chloroaphthalene | ||
|---|---|---|---|---|
| CAS Number | 103028-54-2 | Molecular Weight | 177.63000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8ClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-chloronaphthalen-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8ClN |
|---|---|
| Molecular Weight | 177.63000 |
| Exact Mass | 177.03500 |
| PSA | 26.02000 |
| LogP | 3.65660 |
| InChIKey | BJKRBSSSWLPJPS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)N)C(=C1)Cl |
|
~%
2-Amino-5-chlor... CAS#:103028-54-2 |
| Literature: Clemo; Legg Journal of the Chemical Society, 1947 , p. 539,544 |
|
~%
2-Amino-5-chlor... CAS#:103028-54-2 |
| Literature: Clemo; Legg Journal of the Chemical Society, 1947 , p. 539,544 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Amino-5-chloroaphthalene |
| 5-chloro-[2]naphthylamine |
| 5-Chlor-[2]naphthylamin |
| 1-Chlor-6-naphthylamin |
| 5-Chlor-2-amino-naphthalin |